C12H16F8N2O4 — CID 59874137
2,3,3,3-tetrafluoro-N-[2-[2-[2-(2,3,3,3-tetrafluoropropanoylamino)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 59874137) has the molecular formula C12H16F8N2O4 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-N-[2-[2-[2-(2,3,3,3-tetrafluoropropanoylamino)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-N-[2-[2-[2-(2,3,3,3-tetrafluoropropanoylamino)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 59874137 |
| Molecular Formula | C12H16F8N2O4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2,3,3,3-tetrafluoro-N-[2-[2-[2-(2,3,3,3-tetrafluoropropanoylamino)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | O=C(NCCOCCOCCNC(=O)C(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F8N2O4/c13-7(11(15,16)17)9(23)21-1-3-25-5-6-26-4-2-22-10(24)8(14)12(18,19)20/h7-8H,1-6H2,(H,21,23)(H,22,24) |
| InChIKey | QUNZPVAKCVDGOI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|