About (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate
(4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate (PubChem CID 59874235) has the molecular formula C15H12N4O7S2
and a molecular weight of 424.42 g/mol. Its IUPAC name is (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate.
Molecular Properties
| Compound Name | (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate |
| PubChem CID | 59874235 |
| Molecular Formula | C15H12N4O7S2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate |
| SMILES | Cc1ccc2nnn(S(=O)Oc3ccc(S(C)(=O)=O)c([N+](=O)[O-])c3)c(=O)c2c1 |
| InChI | InChI=1S/C15H12N4O7S2/c1-9-3-5-12-11(7-9)15(20)18(17-16-12)27(23)26-10-4-6-14(28(2,24)25)13(8-10)19(21)22/h3-8H,1-2H3 |
| InChIKey | SYIIRRRRVQRECI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 151.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate?
The IUPAC name of (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate (CID 59874235) is (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate.
What is the SMILES notation for (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate?
The canonical SMILES for (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate is Cc1ccc2nnn(S(=O)Oc3ccc(S(C)(=O)=O)c([N+](=O)[O-])c3)c(=O)c2c1.
What is the InChIKey of (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate?
The InChIKey is SYIIRRRRVQRECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O7S2/c1-9-3-5-12-11(7-9)15(20)18(17-16-12)27(23)26-10-4-6-14(28(2,24)25)13(8-10)19(21)22/h3-8H,1-2H3.
What are the key properties of (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate?
(4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate has a molecular weight of 424.42 g/mol, XLogP of 0.92, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylsulfonyl-3-nitrophenyl) 6-methyl-4-oxo-1,2,3-benzotriazine-3-sulfinate is sourced from PubChem (CID 59874235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).