C12H12Cl2N6O3S — CID 59874269
N-[4-[1-(4,5-dichloro-2-nitrothiophen-3-yl)ethylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide (PubChem CID 59874269) has the molecular formula C12H12Cl2N6O3S and a molecular weight of 391.24 g/mol. Its IUPAC name is N-[4-[1-(4,5-dichloro-2-nitrothiophen-3-yl)ethylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide.
| Compound Name | N-[4-[1-(4,5-dichloro-2-nitrothiophen-3-yl)ethylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 59874269 |
| Molecular Formula | C12H12Cl2N6O3S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | N-[4-[1-(4,5-dichloro-2-nitrothiophen-3-yl)ethylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)nc(NC(C)c2c([N+](=O)[O-])sc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N6O3S/c1-4(7-8(13)9(14)24-10(7)20(22)23)15-11-16-5(2)17-12(19-11)18-6(3)21/h4H,1-3H3,(H2,15,16,17,18,19,21) |
| InChIKey | WIZPCZJQANPJKM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|