C10H15F7O2 — CID 59874925
3-[1,1,2,3,3,3-hexafluoro-2-(fluoromethoxy)propoxy]hexane (PubChem CID 59874925) has the molecular formula C10H15F7O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is 3-[1,1,2,3,3,3-hexafluoro-2-(fluoromethoxy)propoxy]hexane.
| Compound Name | 3-[1,1,2,3,3,3-hexafluoro-2-(fluoromethoxy)propoxy]hexane |
|---|---|
| PubChem CID | 59874925 |
| Molecular Formula | C10H15F7O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-[1,1,2,3,3,3-hexafluoro-2-(fluoromethoxy)propoxy]hexane |
| SMILES | CCCC(CC)OC(F)(F)C(F)(OCF)C(F)(F)F |
| InChI | InChI=1S/C10H15F7O2/c1-3-5-7(4-2)19-10(16,17)8(12,18-6-11)9(13,14)15/h7H,3-6H2,1-2H3 |
| InChIKey | SIRLUHJTYZZYCA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |