About gamma-Methacryloyloxy trimethyl silane
gamma-Methacryloyloxy trimethyl silane (PubChem CID 59874955) has the molecular formula C7H13O2Si
and a molecular weight of 157.26 g/mol.
Molecular Properties
| Compound Name | gamma-Methacryloyloxy trimethyl silane |
| PubChem CID | 59874955 |
| Molecular Formula | C7H13O2Si |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OC[Si](C)C |
| InChI | InChI=1S/C7H13O2Si/c1-6(2)7(8)9-5-10(3)4/h1,5H2,2-4H3 |
| InChIKey | WZANVYBORCZGHQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze gamma-Methacryloyloxy trimethyl silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gamma-Methacryloyloxy trimethyl silane?
The IUPAC name of gamma-Methacryloyloxy trimethyl silane (CID 59874955) is not available.
What is the SMILES notation for gamma-Methacryloyloxy trimethyl silane?
The canonical SMILES for gamma-Methacryloyloxy trimethyl silane is C=C(C)C(=O)OC[Si](C)C.
What is the InChIKey of gamma-Methacryloyloxy trimethyl silane?
The InChIKey is WZANVYBORCZGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O2Si/c1-6(2)7(8)9-5-10(3)4/h1,5H2,2-4H3.
What are the key properties of gamma-Methacryloyloxy trimethyl silane?
gamma-Methacryloyloxy trimethyl silane has a molecular weight of 157.26 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gamma-Methacryloyloxy trimethyl silane is sourced from PubChem (CID 59874955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).