C31H33F4N5O9P2 — CID 59875014
[[4-[3-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 59875014) has the molecular formula C31H33F4N5O9P2 and a molecular weight of 757.57 g/mol. Its IUPAC name is [[4-[3-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[3-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 59875014 |
| Molecular Formula | C31H33F4N5O9P2 |
| Molecular Weight | 757.57 g/mol |
| Exact Mass | 757.17 |
| IUPAC Name | [[4-[3-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | NC(=O)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(=O)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(=O)C(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H33F4N5O9P2/c32-30(33,50(44,45)46)20-9-5-17(6-10-20)13-25(27(37)41)39-29(43)26(14-18-7-11-21(12-8-18)31(34,35)51(47,48)49)40-28(42)23(36)15-19-16-38-24-4-2-1-3-22(19)24/h1-12,16,23,25-26,38H,13-15,36H2,(H2,37,41)(H,39,43)(H,40,42)(H2,44,45,46)(H2,47,48,49) |
| InChIKey | ARSFNBVDIDEAKT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 258.16 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|