C8H14O — CID 59875216
(2R,3R)-3-ethyl-2-methyl-2-[(E)-prop-1-enyl]oxirane (PubChem CID 59875216) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2R,3R)-3-ethyl-2-methyl-2-[(E)-prop-1-enyl]oxirane.
| Compound Name | (2R,3R)-3-ethyl-2-methyl-2-[(E)-prop-1-enyl]oxirane |
|---|---|
| PubChem CID | 59875216 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2R,3R)-3-ethyl-2-methyl-2-[(E)-prop-1-enyl]oxirane |
| SMILES | C/C=C/[C@@]1(C)O[C@@H]1CC |
| InChI | InChI=1S/C8H14O/c1-4-6-8(3)7(5-2)9-8/h4,6-7H,5H2,1-3H3/b6-4+/t7-,8-/m1/s1 |
| InChIKey | KCEGRGSSCIUMPO-CTDODENGSA-N |
| XLogP | 2.13 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|