About actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol
actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol (PubChem CID 59875225) has the molecular formula C6H10AcO2
and a molecular weight of 341.14 g/mol. Its IUPAC name is actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol.
Molecular Properties
| Compound Name | actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol |
| PubChem CID | 59875225 |
| Molecular Formula | C6H10AcO2 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol |
| SMILES | C/C=C/C1OC1CO.[Ac] |
| InChI | InChI=1S/C6H10O2.Ac/c1-2-3-5-6(4-7)8-5;/h2-3,5-7H,4H2,1H3;/b3-2+; |
| InChIKey | VTVYFOYHKCLSMW-SQQVDAMQSA-N |
| XLogP | 0.32 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol?
The IUPAC name of actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol (CID 59875225) is actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol.
What is the SMILES notation for actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol?
The canonical SMILES for actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol is C/C=C/C1OC1CO.[Ac].
What is the InChIKey of actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol?
The InChIKey is VTVYFOYHKCLSMW-SQQVDAMQSA-N. The full InChI is InChI=1S/C6H10O2.Ac/c1-2-3-5-6(4-7)8-5;/h2-3,5-7H,4H2,1H3;/b3-2+;.
What are the key properties of actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol?
actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol has a molecular weight of 341.14 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[3-[(E)-prop-1-enyl]oxiran-2-yl]methanol is sourced from PubChem (CID 59875225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).