C11H14F2N2O2 — CID 59876005
2-(2,2-difluoro-1,3-dioxan-5-yl)-5-propylpyrimidine (PubChem CID 59876005) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-dioxan-5-yl)-5-propylpyrimidine.
| Compound Name | 2-(2,2-difluoro-1,3-dioxan-5-yl)-5-propylpyrimidine |
|---|---|
| PubChem CID | 59876005 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(2,2-difluoro-1,3-dioxan-5-yl)-5-propylpyrimidine |
| SMILES | CCCc1cnc(C2COC(F)(F)OC2)nc1 |
| InChI | InChI=1S/C11H14F2N2O2/c1-2-3-8-4-14-10(15-5-8)9-6-16-11(12,13)17-7-9/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | FHOZPGIIACUPHA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |