About (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate
(2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate (PubChem CID 59876014) has the molecular formula C12H14F2N2O4
and a molecular weight of 288.25 g/mol. Its IUPAC name is (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate |
| PubChem CID | 59876014 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate |
| SMILES | CCCc1cnc(C(=O)OC2COC(F)(F)OC2)nc1 |
| InChI | InChI=1S/C12H14F2N2O4/c1-2-3-8-4-15-10(16-5-8)11(17)20-9-6-18-12(13,14)19-7-9/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | DLQFARRPZRRYPI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate?
The IUPAC name of (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate (CID 59876014) is (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate.
What is the SMILES notation for (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate?
The canonical SMILES for (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate is CCCc1cnc(C(=O)OC2COC(F)(F)OC2)nc1.
What is the InChIKey of (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate?
The InChIKey is DLQFARRPZRRYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O4/c1-2-3-8-4-15-10(16-5-8)11(17)20-9-6-18-12(13,14)19-7-9/h4-5,9H,2-3,6-7H2,1H3.
What are the key properties of (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate?
(2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate has a molecular weight of 288.25 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluoro-1,3-dioxan-5-yl) 5-propylpyrimidine-2-carboxylate is sourced from PubChem (CID 59876014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).