About 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine
5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine (PubChem CID 59876036) has the molecular formula C14H20F2N2O2
and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine.
Molecular Properties
| Compound Name | 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine |
| PubChem CID | 59876036 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine |
| SMILES | CCCCc1cnc(CCC2COC(F)(F)OC2)nc1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-2-3-4-11-7-17-13(18-8-11)6-5-12-9-19-14(15,16)20-10-12/h7-8,12H,2-6,9-10H2,1H3 |
| InChIKey | RUQDTRAFBUKGEX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine?
The IUPAC name of 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine (CID 59876036) is 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine.
What is the SMILES notation for 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine?
The canonical SMILES for 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine is CCCCc1cnc(CCC2COC(F)(F)OC2)nc1.
What is the InChIKey of 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine?
The InChIKey is RUQDTRAFBUKGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O2/c1-2-3-4-11-7-17-13(18-8-11)6-5-12-9-19-14(15,16)20-10-12/h7-8,12H,2-6,9-10H2,1H3.
What are the key properties of 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine?
5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine has a molecular weight of 286.32 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethyl]pyrimidine is sourced from PubChem (CID 59876036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).