C23H34O6 — CID 59876534
[(4E)-4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] propanoate (PubChem CID 59876534) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is [(4E)-4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] propanoate.
| Compound Name | [(4E)-4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 59876534 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(4E)-4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolan-3-yl] propanoate |
| SMILES | C=C1CCC2[C@](C)(CO)C(O)CC[C@]2(C)[C@H]1C/C=C1/C(=O)OCC1OC(=O)CC |
| InChI | InChI=1S/C23H34O6/c1-5-20(26)29-17-12-28-21(27)15(17)7-8-16-14(2)6-9-18-22(16,3)11-10-19(25)23(18,4)13-24/h7,16-19,24-25H,2,5-6,8-13H2,1,3-4H3/b15-7+/t16-,17?,18?,19?,22+,23-/m0/s1 |
| InChIKey | MJVLDMCIIODBBB-UYGJACPPSA-N |
| XLogP | 2.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|