C29H44O7 — CID 59876603
1-O-ethyl 5-O-(1-methoxyethenyl) 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate (PubChem CID 59876603) has the molecular formula C29H44O7 and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-O-ethyl 5-O-(1-methoxyethenyl) 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-ethyl 5-O-(1-methoxyethenyl) 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59876603 |
| Molecular Formula | C29H44O7 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 1-O-ethyl 5-O-(1-methoxyethenyl) 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate |
| SMILES | C=C(OC)OC(=O)C(CC)CC(CC(C)(C)C(=O)OCC)C(=O)OC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C29H44O7/c1-7-17(26(30)35-16(3)33-6)11-21(15-29(4,5)28(32)34-8-2)27(31)36-23-14-20-13-22(23)25-19-10-9-18(12-19)24(20)25/h17-25H,3,7-15H2,1-2,4-6H3 |
| InChIKey | YIDWGDSMMSAFGM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|