C32H50O2 — CID 59876720
2-[(5aR,5bR,11aS)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]-2-oxoacetaldehyde (PubChem CID 59876720) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is 2-[(5aR,5bR,11aS)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(5aR,5bR,11aS)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 59876720 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | 2-[(5aR,5bR,11aS)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]-2-oxoacetaldehyde |
| SMILES | C=C(C)C1CCC2(C)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(C(=O)C=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C32H50O2/c1-20(2)21-11-14-29(5)17-18-31(7)23(27(21)29)9-10-26-30(6)15-12-22(24(34)19-33)28(3,4)25(30)13-16-32(26,31)8/h19,21-23,25-27H,1,9-18H2,2-8H3/t21?,22?,23?,25?,26?,27?,29?,30-,31+,32+/m0/s1 |
| InChIKey | PQUYLBJGSOTEEF-IATZSESISA-N |
| XLogP | 8.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|