About 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane
5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane (PubChem CID 59876818) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane |
| PubChem CID | 59876818 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane |
| SMILES | CC1COC(C2CC(C)C(C)C(C)C2)OC1 |
| InChI | InChI=1S/C14H26O2/c1-9-7-15-14(16-8-9)13-5-10(2)12(4)11(3)6-13/h9-14H,5-8H2,1-4H3 |
| InChIKey | UKQVWCVPVCPCGW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane?
The IUPAC name of 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane (CID 59876818) is 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane.
What is the SMILES notation for 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane?
The canonical SMILES for 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane is CC1COC(C2CC(C)C(C)C(C)C2)OC1.
What is the InChIKey of 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane?
The InChIKey is UKQVWCVPVCPCGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-9-7-15-14(16-8-9)13-5-10(2)12(4)11(3)6-13/h9-14H,5-8H2,1-4H3.
What are the key properties of 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane?
5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane has a molecular weight of 226.36 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(3,4,5-trimethylcyclohexyl)-1,3-dioxane is sourced from PubChem (CID 59876818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).