C16H19N3OS — CID 59877340
2-[(2E)-2-hydrazinylidene-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl]-1-(4-methylphenyl)ethanone (PubChem CID 59877340) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[(2E)-2-hydrazinylidene-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[(2E)-2-hydrazinylidene-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 59877340 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[(2E)-2-hydrazinylidene-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl]-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)Cn2c3c(s/c2=N/N)CCCC3)cc1 |
| InChI | InChI=1S/C16H19N3OS/c1-11-6-8-12(9-7-11)14(20)10-19-13-4-2-3-5-15(13)21-16(19)18-17/h6-9H,2-5,10,17H2,1H3/b18-16+ |
| InChIKey | FGVPBNHVQUORLX-FBMGVBCBSA-N |
| XLogP | 2.39 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|