C21H29FO2 — CID 59877624
(17Z)-17-(1-fluoro-2-hydroxyethylidene)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 59877624) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is (17Z)-17-(1-fluoro-2-hydroxyethylidene)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (17Z)-17-(1-fluoro-2-hydroxyethylidene)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59877624 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (17Z)-17-(1-fluoro-2-hydroxyethylidene)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)/C(=C(\F)CO)C=CC12 |
| InChI | InChI=1S/C21H29FO2/c1-20-9-7-14(24)11-13(20)3-4-15-16-5-6-18(19(22)12-23)21(16,2)10-8-17(15)20/h3,5-6,14-17,23-24H,4,7-12H2,1-2H3/b19-18- |
| InChIKey | HZAKOZAJGITCEL-HNENSFHCSA-N |
| XLogP | 4.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|