C19H26AcO2 — CID 59877657
actinium;17-hydroxy-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 59877657) has the molecular formula C19H26AcO2 and a molecular weight of 513.42 g/mol. Its IUPAC name is actinium;17-hydroxy-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | actinium;17-hydroxy-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 59877657 |
| Molecular Formula | C19H26AcO2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | actinium;17-hydroxy-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1C=CC1C2CCC2(C)C(O)CCC12.[Ac] |
| InChI | InChI=1S/C19H26O2.Ac/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;/h3-4,11,14-17,21H,5-10H2,1-2H3; |
| InChIKey | NVQUPSXUGDPEQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |