About N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide
N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide (PubChem CID 59877738) has the molecular formula C9H15N3O3S
and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide |
| PubChem CID | 59877738 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide |
| SMILES | CC(=O)NCCSC[C@@]1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C9H15N3O3S/c1-6(13)10-3-4-16-5-9(2)7(14)11-8(15)12-9/h3-5H2,1-2H3,(H,10,13)(H2,11,12,14,15)/t9-/m1/s1 |
| InChIKey | YTUNEJDTKGUERU-SECBINFHSA-N |
| XLogP | -0.55 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide?
The IUPAC name of N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide (CID 59877738) is N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide.
What is the SMILES notation for N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide?
The canonical SMILES for N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide is CC(=O)NCCSC[C@@]1(C)NC(=O)NC1=O.
What is the InChIKey of N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide?
The InChIKey is YTUNEJDTKGUERU-SECBINFHSA-N. The full InChI is InChI=1S/C9H15N3O3S/c1-6(13)10-3-4-16-5-9(2)7(14)11-8(15)12-9/h3-5H2,1-2H3,(H,10,13)(H2,11,12,14,15)/t9-/m1/s1.
What are the key properties of N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide?
N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide has a molecular weight of 245.30 g/mol, XLogP of -0.55, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]ethyl]acetamide is sourced from PubChem (CID 59877738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).