About (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol
(2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol (PubChem CID 59877941) has the molecular formula C5H10N2OS
and a molecular weight of 146.22 g/mol. Its IUPAC name is (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol |
| PubChem CID | 59877941 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol |
| SMILES | CC1SC(N)=NC1CO |
| InChI | InChI=1S/C5H10N2OS/c1-3-4(2-8)7-5(6)9-3/h3-4,8H,2H2,1H3,(H2,6,7) |
| InChIKey | DHEPJYISYQRKBC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol?
The IUPAC name of (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol (CID 59877941) is (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol.
What is the SMILES notation for (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol?
The canonical SMILES for (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol is CC1SC(N)=NC1CO.
What is the InChIKey of (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol?
The InChIKey is DHEPJYISYQRKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2OS/c1-3-4(2-8)7-5(6)9-3/h3-4,8H,2H2,1H3,(H2,6,7).
What are the key properties of (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol?
(2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol has a molecular weight of 146.22 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-methyl-4,5-dihydro-1,3-thiazol-4-yl)methanol is sourced from PubChem (CID 59877941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).