About 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea
1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea (PubChem CID 59877944) has the molecular formula C9H20N2O2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea |
| PubChem CID | 59877944 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea |
| SMILES | CC(O)C(CO)NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C9H20N2O2S/c1-6(13)7(5-12)10-8(14)11-9(2,3)4/h6-7,12-13H,5H2,1-4H3,(H2,10,11,14) |
| InChIKey | SFNMJQKPEABOPG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea?
The IUPAC name of 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea (CID 59877944) is 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea.
What is the SMILES notation for 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea?
The canonical SMILES for 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea is CC(O)C(CO)NC(=S)NC(C)(C)C.
What is the InChIKey of 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea?
The InChIKey is SFNMJQKPEABOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2S/c1-6(13)7(5-12)10-8(14)11-9(2,3)4/h6-7,12-13H,5H2,1-4H3,(H2,10,11,14).
What are the key properties of 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea?
1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea has a molecular weight of 220.34 g/mol, XLogP of -0.01, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(1,3-dihydroxybutan-2-yl)thiourea is sourced from PubChem (CID 59877944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).