C18H25NO2 — CID 59878204
1-[2,4,5-trimethyl-3-(4,4,5,5-tetramethyl-1,2-oxazol-3-yl)phenyl]ethanone (PubChem CID 59878204) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[2,4,5-trimethyl-3-(4,4,5,5-tetramethyl-1,2-oxazol-3-yl)phenyl]ethanone.
| Compound Name | 1-[2,4,5-trimethyl-3-(4,4,5,5-tetramethyl-1,2-oxazol-3-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 59878204 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[2,4,5-trimethyl-3-(4,4,5,5-tetramethyl-1,2-oxazol-3-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(C)c(C)c(C2=NOC(C)(C)C2(C)C)c1C |
| InChI | InChI=1S/C18H25NO2/c1-10-9-14(13(4)20)12(3)15(11(10)2)16-17(5,6)18(7,8)21-19-16/h9H,1-8H3 |
| InChIKey | IQQKVSGEZLCYON-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |