C26H28N4O6 — CID 59878305
benzyl 2-[3-[[1-[(2-methyl-1-benzofuran-5-yl)amino]-2-nitroethenyl]amino]-2-oxoazepan-1-yl]acetate (PubChem CID 59878305) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is benzyl 2-[3-[[1-[(2-methyl-1-benzofuran-5-yl)amino]-2-nitroethenyl]amino]-2-oxoazepan-1-yl]acetate.
| Compound Name | benzyl 2-[3-[[1-[(2-methyl-1-benzofuran-5-yl)amino]-2-nitroethenyl]amino]-2-oxoazepan-1-yl]acetate |
|---|---|
| PubChem CID | 59878305 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | benzyl 2-[3-[[1-[(2-methyl-1-benzofuran-5-yl)amino]-2-nitroethenyl]amino]-2-oxoazepan-1-yl]acetate |
| SMILES | Cc1cc2cc(NC(=C[N+](=O)[O-])NC3CCCCN(CC(=O)OCc4ccccc4)C3=O)ccc2o1 |
| InChI | InChI=1S/C26H28N4O6/c1-18-13-20-14-21(10-11-23(20)36-18)27-24(15-30(33)34)28-22-9-5-6-12-29(26(22)32)16-25(31)35-17-19-7-3-2-4-8-19/h2-4,7-8,10-11,13-15,22,27-28H,5-6,9,12,16-17H2,1H3 |
| InChIKey | FDBAZZFZWAGYDV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|