C13H14N2O4 — CID 59878495
diethyl (2E,5E)-2,6-dicyanohepta-2,5-dienedioate (PubChem CID 59878495) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is diethyl (2E,5E)-2,6-dicyanohepta-2,5-dienedioate.
| Compound Name | diethyl (2E,5E)-2,6-dicyanohepta-2,5-dienedioate |
|---|---|
| PubChem CID | 59878495 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | diethyl (2E,5E)-2,6-dicyanohepta-2,5-dienedioate |
| SMILES | CCOC(=O)/C(C#N)=C/C/C=C(\C#N)C(=O)OCC |
| InChI | InChI=1S/C13H14N2O4/c1-3-18-12(16)10(8-14)6-5-7-11(9-15)13(17)19-4-2/h6-7H,3-5H2,1-2H3/b10-6+,11-7+ |
| InChIKey | JPCGYTISGZUZCT-JMQWPVDRSA-N |
| XLogP | 1.40 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|