C9H16N4O — CID 59878542
N-[C-[3-(2-aminoethyl)-2,5-dihydropyrrol-1-yl]-N-methylcarbonimidoyl]formamide (PubChem CID 59878542) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-[C-[3-(2-aminoethyl)-2,5-dihydropyrrol-1-yl]-N-methylcarbonimidoyl]formamide.
| Compound Name | N-[C-[3-(2-aminoethyl)-2,5-dihydropyrrol-1-yl]-N-methylcarbonimidoyl]formamide |
|---|---|
| PubChem CID | 59878542 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-[C-[3-(2-aminoethyl)-2,5-dihydropyrrol-1-yl]-N-methylcarbonimidoyl]formamide |
| SMILES | C/N=C(\NC=O)N1CC=C(CCN)C1 |
| InChI | InChI=1S/C9H16N4O/c1-11-9(12-7-14)13-5-3-8(6-13)2-4-10/h3,7H,2,4-6,10H2,1H3,(H,11,12,14) |
| InChIKey | CTJWUMIYEPCLAG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|