C21H34O3 — CID 59878677
2-[(2E,4E,6E)-7-(5,5-dimethyloxan-2-yl)octa-2,4,6-trien-2-yl]-5,5-dimethyl-1,3-dioxane (PubChem CID 59878677) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-7-(5,5-dimethyloxan-2-yl)octa-2,4,6-trien-2-yl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[(2E,4E,6E)-7-(5,5-dimethyloxan-2-yl)octa-2,4,6-trien-2-yl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 59878677 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-[(2E,4E,6E)-7-(5,5-dimethyloxan-2-yl)octa-2,4,6-trien-2-yl]-5,5-dimethyl-1,3-dioxane |
| SMILES | C/C(=C\C=C\C=C(/C)C1OCC(C)(C)CO1)C1CCC(C)(C)CO1 |
| InChI | InChI=1S/C21H34O3/c1-16(18-11-12-20(3,4)13-22-18)9-7-8-10-17(2)19-23-14-21(5,6)15-24-19/h7-10,18-19H,11-15H2,1-6H3/b8-7+,16-9+,17-10+ |
| InChIKey | VRJDDLMCZKJLFC-PMBKHFCGSA-N |
| XLogP | 5.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|