C24H24 — CID 59878731
1-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-8-phenylnaphthalene (PubChem CID 59878731) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-8-phenylnaphthalene.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-8-phenylnaphthalene |
|---|---|
| PubChem CID | 59878731 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]-3,6-dimethyl-8-phenylnaphthalene |
| SMILES | C/C=C\C=C(/C)c1cc(C)cc2cc(C)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C24H24/c1-5-6-10-19(4)22-15-17(2)13-21-14-18(3)16-23(24(21)22)20-11-8-7-9-12-20/h5-16H,1-4H3/b6-5-,19-10+ |
| InChIKey | KHCIJUHWYKXFJX-IZDPDWRWSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|