C16H27N — CID 59879318
(4aS,8aR)-6-(4-methylpent-3-enyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-amine (PubChem CID 59879318) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (4aS,8aR)-6-(4-methylpent-3-enyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-amine.
| Compound Name | (4aS,8aR)-6-(4-methylpent-3-enyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 59879318 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (4aS,8aR)-6-(4-methylpent-3-enyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-amine |
| SMILES | CC(C)=CCCC1=CC[C@H]2C(N)CCC[C@H]2C1 |
| InChI | InChI=1S/C16H27N/c1-12(2)5-3-6-13-9-10-15-14(11-13)7-4-8-16(15)17/h5,9,14-16H,3-4,6-8,10-11,17H2,1-2H3/t14-,15+,16?/m0/s1 |
| InChIKey | GZBPBCSPJFWMGZ-QMRHZFGWSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|