C11H21N — CID 59879347
(2R,3S)-2,3,6,6-tetramethylcyclohept-4-en-1-amine (PubChem CID 59879347) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2R,3S)-2,3,6,6-tetramethylcyclohept-4-en-1-amine.
| Compound Name | (2R,3S)-2,3,6,6-tetramethylcyclohept-4-en-1-amine |
|---|---|
| PubChem CID | 59879347 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2R,3S)-2,3,6,6-tetramethylcyclohept-4-en-1-amine |
| SMILES | C[C@H]1C=CC(C)(C)CC(N)[C@@H]1C |
| InChI | InChI=1S/C11H21N/c1-8-5-6-11(3,4)7-10(12)9(8)2/h5-6,8-10H,7,12H2,1-4H3/t8-,9+,10?/m0/s1 |
| InChIKey | YSGUOEMUVBVIHG-QIIDTADFSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|