C24H20Cl2N2O2 — CID 59879524
(5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[(4-phenylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 59879524) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[(4-phenylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[(4-phenylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59879524 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (5R)-3-(3,5-dichlorophenyl)-1,5-dimethyl-5-[(4-phenylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@@]1(C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-24(15-16-8-10-18(11-9-16)17-6-4-3-5-7-17)22(29)28(23(30)27(24)2)21-13-19(25)12-20(26)14-21/h3-14H,15H2,1-2H3/t24-/m1/s1 |
| InChIKey | OWPHMAPLJKMOOW-XMMPIXPASA-N |
| XLogP | 6.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|