C21H22BrCl2N3O2 — CID 59879535
(5R)-1-(4-aminobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 59879535) has the molecular formula C21H22BrCl2N3O2 and a molecular weight of 499.24 g/mol. Its IUPAC name is (5R)-1-(4-aminobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-1-(4-aminobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59879535 |
| Molecular Formula | C21H22BrCl2N3O2 |
| Molecular Weight | 499.24 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | (5R)-1-(4-aminobutyl)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1CCCCN |
| InChI | InChI=1S/C21H22BrCl2N3O2/c1-21(13-14-4-6-15(22)7-5-14)19(28)27(18-11-16(23)10-17(24)12-18)20(29)26(21)9-3-2-8-25/h4-7,10-12H,2-3,8-9,13,25H2,1H3/t21-/m1/s1 |
| InChIKey | HKISOFIFNZHRRA-OAQYLSRUSA-N |
| XLogP | 5.26 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.24 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|