About CID 59879592
CID 59879592 (PubChem CID 59879592) has the molecular formula C17H32O3Si
and a molecular weight of 312.53 g/mol.
Molecular Properties
| Compound Name | CID 59879592 |
| PubChem CID | 59879592 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | — |
| SMILES | C=CC(CO)CC(CC=CCO)CC[Si]CCCCOC |
| InChI | InChI=1S/C17H32O3Si/c1-3-16(15-19)14-17(8-4-5-10-18)9-13-21-12-7-6-11-20-2/h3-5,16-19H,1,6-15H2,2H3 |
| InChIKey | VAJXUZXTIDQKPI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59879592 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59879592?
The IUPAC name of CID 59879592 (CID 59879592) is not available.
What is the SMILES notation for CID 59879592?
The canonical SMILES for CID 59879592 is C=CC(CO)CC(CC=CCO)CC[Si]CCCCOC.
What is the InChIKey of CID 59879592?
The InChIKey is VAJXUZXTIDQKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3Si/c1-3-16(15-19)14-17(8-4-5-10-18)9-13-21-12-7-6-11-20-2/h3-5,16-19H,1,6-15H2,2H3.
What are the key properties of CID 59879592?
CID 59879592 has a molecular weight of 312.53 g/mol, XLogP of 3.08, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59879592 is sourced from PubChem (CID 59879592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).