C24H12F9N3 — CID 598796
2,4,6-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine (PubChem CID 598796) has the molecular formula C24H12F9N3 and a molecular weight of 513.36 g/mol. Its IUPAC name is 2,4,6-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 598796 |
| Molecular Formula | C24H12F9N3 |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 2,4,6-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)nc(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H12F9N3/c25-22(26,27)16-7-1-13(2-8-16)19-34-20(14-3-9-17(10-4-14)23(28,29)30)36-21(35-19)15-5-11-18(12-6-15)24(31,32)33/h1-12H |
| InChIKey | LZTFCGOOPAGYTN-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |