About (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one
(3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one (PubChem CID 59879618) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one |
| PubChem CID | 59879618 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one |
| SMILES | C/C=C/[C@@H](C)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C10H17NO/c1-3-4-8(2)7-9-5-6-11-10(9)12/h3-4,8-9H,5-7H2,1-2H3,(H,11,12)/b4-3+/t8-,9+/m1/s1 |
| InChIKey | SBQCANWELKJQCD-BKIAHZASSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one?
The IUPAC name of (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one (CID 59879618) is (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one.
What is the SMILES notation for (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one?
The canonical SMILES for (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one is C/C=C/[C@@H](C)C[C@@H]1CCNC1=O.
What is the InChIKey of (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one?
The InChIKey is SBQCANWELKJQCD-BKIAHZASSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-4-8(2)7-9-5-6-11-10(9)12/h3-4,8-9H,5-7H2,1-2H3,(H,11,12)/b4-3+/t8-,9+/m1/s1.
What are the key properties of (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one?
(3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one has a molecular weight of 167.25 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(E,2S)-2-methylpent-3-enyl]pyrrolidin-2-one is sourced from PubChem (CID 59879618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).