C5H10Na2O8S2 — CID 59880392
disodium;1,5-dihydroxypentane-1,5-disulfonate (PubChem CID 59880392) has the molecular formula C5H10Na2O8S2 and a molecular weight of 308.24 g/mol. Its IUPAC name is disodium;1,5-dihydroxypentane-1,5-disulfonate.
| Compound Name | disodium;1,5-dihydroxypentane-1,5-disulfonate |
|---|---|
| PubChem CID | 59880392 |
| Molecular Formula | C5H10Na2O8S2 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | disodium;1,5-dihydroxypentane-1,5-disulfonate |
| SMILES | O=S(=O)([O-])C(O)CCCC(O)S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H12O8S2.2Na/c6-4(14(8,9)10)2-1-3-5(7)15(11,12)13;;/h4-7H,1-3H2,(H,8,9,10)(H,11,12,13);;/q;2*+1/p-2 |
| InChIKey | YGZZDQOCTFVBFC-UHFFFAOYSA-L |
| XLogP | -8.11 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|