About (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine
(3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine (PubChem CID 59880662) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine.
Molecular Properties
| Compound Name | (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine |
| PubChem CID | 59880662 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine |
| SMILES | Cc1ncn(C[C@@H]2CCCN(C(C)(C)C)C2)c1C |
| InChI | InChI=1S/C15H27N3/c1-12-13(2)17(11-16-12)9-14-7-6-8-18(10-14)15(3,4)5/h11,14H,6-10H2,1-5H3/t14-/m0/s1 |
| InChIKey | NDVIYNSTTSMZNI-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine?
The IUPAC name of (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine (CID 59880662) is (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine.
What is the SMILES notation for (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine?
The canonical SMILES for (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine is Cc1ncn(C[C@@H]2CCCN(C(C)(C)C)C2)c1C.
What is the InChIKey of (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine?
The InChIKey is NDVIYNSTTSMZNI-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H27N3/c1-12-13(2)17(11-16-12)9-14-7-6-8-18(10-14)15(3,4)5/h11,14H,6-10H2,1-5H3/t14-/m0/s1.
What are the key properties of (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine?
(3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine has a molecular weight of 249.40 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-tert-butyl-3-[(4,5-dimethylimidazol-1-yl)methyl]piperidine is sourced from PubChem (CID 59880662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).