C21H23ClFN3O — CID 59880935
1-[(2R)-4-[(2S)-13-chloro-6-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone (PubChem CID 59880935) has the molecular formula C21H23ClFN3O and a molecular weight of 387.89 g/mol. Its IUPAC name is 1-[(2R)-4-[(2S)-13-chloro-6-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone.
| Compound Name | 1-[(2R)-4-[(2S)-13-chloro-6-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 59880935 |
| Molecular Formula | C21H23ClFN3O |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[(2R)-4-[(2S)-13-chloro-6-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1CN([C@H]2c3ccc(Cl)cc3CCc3cc(F)cnc32)CCN1C |
| InChI | InChI=1S/C21H23ClFN3O/c1-13(27)19-12-26(8-7-25(19)2)21-18-6-5-16(22)9-14(18)3-4-15-10-17(23)11-24-20(15)21/h5-6,9-11,19,21H,3-4,7-8,12H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | JPZQDYHNWPVRHU-CTNGQTDRSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |