About 2,4-dihydroxybut-2-enal
2,4-dihydroxybut-2-enal (PubChem CID 59881068) has the molecular formula C4H6O3
and a molecular weight of 102.09 g/mol. Its IUPAC name is 2,4-dihydroxybut-2-enal.
Molecular Properties
| Compound Name | 2,4-dihydroxybut-2-enal |
| PubChem CID | 59881068 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | 2,4-dihydroxybut-2-enal |
| SMILES | O=CC(O)=CCO |
| InChI | InChI=1S/C4H6O3/c5-2-1-4(7)3-6/h1,3,5,7H,2H2 |
| InChIKey | AOAADFRCWKRGKO-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxybut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxybut-2-enal?
The IUPAC name of 2,4-dihydroxybut-2-enal (CID 59881068) is 2,4-dihydroxybut-2-enal.
What is the SMILES notation for 2,4-dihydroxybut-2-enal?
The canonical SMILES for 2,4-dihydroxybut-2-enal is O=CC(O)=CCO.
What is the InChIKey of 2,4-dihydroxybut-2-enal?
The InChIKey is AOAADFRCWKRGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3/c5-2-1-4(7)3-6/h1,3,5,7H,2H2.
What are the key properties of 2,4-dihydroxybut-2-enal?
2,4-dihydroxybut-2-enal has a molecular weight of 102.09 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxybut-2-enal is sourced from PubChem (CID 59881068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).