About N-phenylpiperidin-4-amine;propane;vanadium(2+)
N-phenylpiperidin-4-amine;propane;vanadium(2+) (PubChem CID 59881354) has the molecular formula C14H22N2V
and a molecular weight of 269.29 g/mol. Its IUPAC name is N-phenylpiperidin-4-amine;propane;vanadium(2+).
Molecular Properties
| Compound Name | N-phenylpiperidin-4-amine;propane;vanadium(2+) |
| PubChem CID | 59881354 |
| Molecular Formula | C14H22N2V |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-phenylpiperidin-4-amine;propane;vanadium(2+) |
| SMILES | [CH2-]CC.[V+2].[c-]1ccc(NC2CCNCC2)cc1 |
| InChI | InChI=1S/C11H15N2.C3H7.V/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11;1-3-2;/h2-5,11-13H,6-9H2;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | GTYLKEPXKOYKND-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-phenylpiperidin-4-amine;propane;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylpiperidin-4-amine;propane;vanadium(2+)?
The IUPAC name of N-phenylpiperidin-4-amine;propane;vanadium(2+) (CID 59881354) is N-phenylpiperidin-4-amine;propane;vanadium(2+).
What is the SMILES notation for N-phenylpiperidin-4-amine;propane;vanadium(2+)?
The canonical SMILES for N-phenylpiperidin-4-amine;propane;vanadium(2+) is [CH2-]CC.[V+2].[c-]1ccc(NC2CCNCC2)cc1.
What is the InChIKey of N-phenylpiperidin-4-amine;propane;vanadium(2+)?
The InChIKey is GTYLKEPXKOYKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2.C3H7.V/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11;1-3-2;/h2-5,11-13H,6-9H2;1,3H2,2H3;/q2*-1;+2.
What are the key properties of N-phenylpiperidin-4-amine;propane;vanadium(2+)?
N-phenylpiperidin-4-amine;propane;vanadium(2+) has a molecular weight of 269.29 g/mol, XLogP of 2.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylpiperidin-4-amine;propane;vanadium(2+) is sourced from PubChem (CID 59881354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).