C7H17N3 — CID 59881570
1,2,3,4,5-pentamethyl-1,2,4-triazolidine (PubChem CID 59881570) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-1,2,4-triazolidine.
| Compound Name | 1,2,3,4,5-pentamethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 59881570 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-1,2,4-triazolidine |
| SMILES | CC1N(C)C(C)N(C)N1C |
| InChI | InChI=1S/C7H17N3/c1-6-8(3)7(2)10(5)9(6)4/h6-7H,1-5H3 |
| InChIKey | LAYLXBMJQPSUCH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |