C27H26FN5O3P2 — CID 59882408
[fluoro(phosphanyl)phosphanyl] 6-[2-(N-ethyl-4-phenyldiazenylanilino)acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 59882408) has the molecular formula C27H26FN5O3P2 and a molecular weight of 549.48 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 6-[2-(N-ethyl-4-phenyldiazenylanilino)acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | [fluoro(phosphanyl)phosphanyl] 6-[2-(N-ethyl-4-phenyldiazenylanilino)acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 59882408 |
| Molecular Formula | C27H26FN5O3P2 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 6-[2-(N-ethyl-4-phenyldiazenylanilino)acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CCN(CC(=O)N1CCc2c1ccc1[nH]c(C(=O)OP(F)P)cc21)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26FN5O3P2/c1-2-32(20-10-8-19(9-11-20)31-30-18-6-4-3-5-7-18)17-26(34)33-15-14-21-22-16-24(27(35)36-38(28)37)29-23(22)12-13-25(21)33/h3-13,16,29H,2,14-15,17,37H2,1H3/b31-30+ |
| InChIKey | CEPJVFZQLSFOQN-NVQSTNCTSA-N |
| XLogP | 7.23 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|