About 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine
3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine (PubChem CID 59882413) has the molecular formula C15H15N5O2S
and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine.
Molecular Properties
| Compound Name | 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine |
| PubChem CID | 59882413 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine |
| SMILES | CN(C)c1ccc(/N=N/c2snc3ccc(NOO)cc23)cc1 |
| InChI | InChI=1S/C15H15N5O2S/c1-20(2)12-6-3-10(4-7-12)16-17-15-13-9-11(18-22-21)5-8-14(13)19-23-15/h3-9,18,21H,1-2H3/b17-16+ |
| InChIKey | CZHQJJLMEPMNHF-WUKNDPDISA-N |
| XLogP | 4.59 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine?
The IUPAC name of 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine (CID 59882413) is 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine.
What is the SMILES notation for 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine?
The canonical SMILES for 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine is CN(C)c1ccc(/N=N/c2snc3ccc(NOO)cc23)cc1.
What is the InChIKey of 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine?
The InChIKey is CZHQJJLMEPMNHF-WUKNDPDISA-N. The full InChI is InChI=1S/C15H15N5O2S/c1-20(2)12-6-3-10(4-7-12)16-17-15-13-9-11(18-22-21)5-8-14(13)19-23-15/h3-9,18,21H,1-2H3/b17-16+.
What are the key properties of 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine?
3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine has a molecular weight of 329.39 g/mol, XLogP of 4.59, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(dimethylamino)phenyl]diazenyl]-N-hydroperoxy-2,1-benzothiazol-5-amine is sourced from PubChem (CID 59882413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).