C28H27ClFN5O3P2 — CID 59882415
[fluoro(phosphanyl)phosphanyl] 6-[2-[4-[(2-chloro-4-methylphenyl)diazenyl]-N-ethylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 59882415) has the molecular formula C28H27ClFN5O3P2 and a molecular weight of 597.96 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 6-[2-[4-[(2-chloro-4-methylphenyl)diazenyl]-N-ethylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[4-[(2-chloro-4-methylphenyl)diazenyl]-N-ethylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 59882415 |
| Molecular Formula | C28H27ClFN5O3P2 |
| Molecular Weight | 597.96 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[4-[(2-chloro-4-methylphenyl)diazenyl]-N-ethylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CCN(CC(=O)N1CCc2c1ccc1[nH]c(C(=O)OP(F)P)cc21)c1ccc(/N=N/c2ccc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C28H27ClFN5O3P2/c1-3-34(19-7-5-18(6-8-19)32-33-24-9-4-17(2)14-22(24)29)16-27(36)35-13-12-20-21-15-25(28(37)38-40(30)39)31-23(21)10-11-26(20)35/h4-11,14-15,31H,3,12-13,16,39H2,1-2H3/b33-32+ |
| InChIKey | ZAXSVKZYCCWVQW-ULIFNZDWSA-N |
| XLogP | 8.19 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.96 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|