C28H45NO5 — CID 59882681
[(3R,8S)-8-[2-[2,2-dimethyl-6-[2-(methylamino)-2-oxoethyl]-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 59882681) has the molecular formula C28H45NO5 and a molecular weight of 475.67 g/mol. Its IUPAC name is [(3R,8S)-8-[2-[2,2-dimethyl-6-[2-(methylamino)-2-oxoethyl]-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(3R,8S)-8-[2-[2,2-dimethyl-6-[2-(methylamino)-2-oxoethyl]-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59882681 |
| Molecular Formula | C28H45NO5 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | [(3R,8S)-8-[2-[2,2-dimethyl-6-[2-(methylamino)-2-oxoethyl]-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C[C@@H](C)C=C2C=CC(C)[C@H](CCC3CC(CC(=O)NC)OC(C)(C)O3)C21 |
| InChI | InChI=1S/C28H45NO5/c1-8-18(3)27(31)32-24-14-17(2)13-20-10-9-19(4)23(26(20)24)12-11-21-15-22(16-25(30)29-7)34-28(5,6)33-21/h9-10,13,17-19,21-24,26H,8,11-12,14-16H2,1-7H3,(H,29,30)/t17-,18?,19?,21?,22?,23-,24?,26?/m0/s1 |
| InChIKey | DQRHLUIWVZFWTK-IRFWKUBRSA-N |
| XLogP | 5.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |