C26H43NO5 — CID 59882683
[(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 59882683) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59882683 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C[C@@H](C)C=C2C=CC(C)[C@H](CCC(O)CC(O)CC(=O)NC)C21 |
| InChI | InChI=1S/C26H43NO5/c1-7-26(4,5)25(31)32-22-13-16(2)12-18-9-8-17(3)21(24(18)22)11-10-19(28)14-20(29)15-23(30)27-6/h8-9,12,16-17,19-22,24,28-29H,7,10-11,13-15H2,1-6H3,(H,27,30)/t16-,17?,19?,20?,21-,22?,24?/m0/s1 |
| InChIKey | MASHTLNCKCOSOJ-PCXJZRIBSA-N |
| XLogP | 3.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |