C25H41NO5 — CID 59882686
[(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 59882686) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59882686 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | [(3R,8S)-8-[3,5-dihydroxy-7-(methylamino)-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C[C@@H](C)C=C2C=CC(C)[C@H](CCC(O)CC(O)CC(=O)NC)C21 |
| InChI | InChI=1S/C25H41NO5/c1-6-16(3)25(30)31-22-12-15(2)11-18-8-7-17(4)21(24(18)22)10-9-19(27)13-20(28)14-23(29)26-5/h7-8,11,15-17,19-22,24,27-28H,6,9-10,12-14H2,1-5H3,(H,26,29)/t15-,16?,17?,19?,20?,21-,22?,24?/m0/s1 |
| InChIKey | GZVODWSXFRKIEC-UIEZHHOJSA-N |
| XLogP | 3.38 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |