About N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide
N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide (PubChem CID 59882823) has the molecular formula C9H14N4O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide.
Molecular Properties
| Compound Name | N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide |
| PubChem CID | 59882823 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide |
| SMILES | [H]/N=C/C(=O)CNC(=O)CC(=O)NCC(=O)NC |
| InChI | InChI=1S/C9H14N4O4/c1-11-9(17)5-13-8(16)2-7(15)12-4-6(14)3-10/h3,10H,2,4-5H2,1H3,(H,11,17)(H,12,15)(H,13,16)/b10-3+ |
| InChIKey | WWIHURJFUIMPRU-XCVCLJGOSA-N |
| XLogP | -2.43 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide?
The IUPAC name of N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide (CID 59882823) is N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide.
What is the SMILES notation for N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide?
The canonical SMILES for N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide is [H]/N=C/C(=O)CNC(=O)CC(=O)NCC(=O)NC.
What is the InChIKey of N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide?
The InChIKey is WWIHURJFUIMPRU-XCVCLJGOSA-N. The full InChI is InChI=1S/C9H14N4O4/c1-11-9(17)5-13-8(16)2-7(15)12-4-6(14)3-10/h3,10H,2,4-5H2,1H3,(H,11,17)(H,12,15)(H,13,16)/b10-3+.
What are the key properties of N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide?
N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide has a molecular weight of 242.23 g/mol, XLogP of -2.43, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imino-2-oxopropyl)-N'-[2-(methylamino)-2-oxoethyl]propanediamide is sourced from PubChem (CID 59882823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).