C23H35NS — CID 59883030
2-tert-butyl-4-[(1Z,5E,7E)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole (PubChem CID 59883030) has the molecular formula C23H35NS and a molecular weight of 357.61 g/mol. Its IUPAC name is 2-tert-butyl-4-[(1Z,5E,7E)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole.
| Compound Name | 2-tert-butyl-4-[(1Z,5E,7E)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 59883030 |
| Molecular Formula | C23H35NS |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-tert-butyl-4-[(1Z,5E,7E)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole |
| SMILES | C=CCC(C)CC/C(C)=C/C=C/CC/C=C\c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C23H35NS/c1-7-13-19(2)16-17-20(3)14-11-9-8-10-12-15-21-18-25-22(24-21)23(4,5)6/h7,9,11-12,14-15,18-19H,1,8,10,13,16-17H2,2-6H3/b11-9+,15-12-,20-14+ |
| InChIKey | KKIBTNXAJPKIJX-RFVCKZEMSA-N |
| XLogP | 7.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|