C12H20FNO3 — CID 59883063
ethyl (Z)-2-fluoro-4-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]but-2-enoate (PubChem CID 59883063) has the molecular formula C12H20FNO3 and a molecular weight of 245.29 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-4-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]but-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-4-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 59883063 |
| Molecular Formula | C12H20FNO3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl (Z)-2-fluoro-4-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]but-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/C[C@H]1COC(C)(C)N1C |
| InChI | InChI=1S/C12H20FNO3/c1-5-16-11(15)10(13)7-6-9-8-17-12(2,3)14(9)4/h7,9H,5-6,8H2,1-4H3/b10-7-/t9-/m0/s1 |
| InChIKey | QHAHAGUYZPMALM-CBFJXKFUSA-N |
| XLogP | 1.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|