C28H52Si — CID 59883211
dimethyl-bis[(2,5,6-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)methyl]silane (PubChem CID 59883211) has the molecular formula C28H52Si and a molecular weight of 416.81 g/mol. Its IUPAC name is dimethyl-bis[(2,5,6-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)methyl]silane.
| Compound Name | dimethyl-bis[(2,5,6-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)methyl]silane |
|---|---|
| PubChem CID | 59883211 |
| Molecular Formula | C28H52Si |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.38 |
| IUPAC Name | dimethyl-bis[(2,5,6-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)methyl]silane |
| SMILES | CC1CC2CC(C)C(C[Si](C)(C)CC3C(C)CC4CC(C)C(C)CC43)C2CC1C |
| InChI | InChI=1S/C28H52Si/c1-17-9-23-11-21(5)27(25(23)13-19(17)3)15-29(7,8)16-28-22(6)12-24-10-18(2)20(4)14-26(24)28/h17-28H,9-16H2,1-8H3 |
| InChIKey | PVLAAQBEGQABSI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|